cas: 42059-81-4 — see every product listed under this CAS number, including other names
3-Formyl-6-methylchromone, 95% (CAS 42059-81-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012002-250MG |
| cas | 42059-81-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 25g | 1393.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-methyl-4-oxochromene-3-carbaldehyde (CAS 42059-81-4) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 6-methyl-4-oxochromene-3-carbaldehyde. InChIKey: GBWMIOYSMWCYIZ-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-methyl-4-oxochromene-3-carbaldehyde |
| InChIKey | GBWMIOYSMWCYIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC=C(C2=O)C=O |
Computed by PubChem (NCBI)