cas: 619-14-7 — see every product listed under this CAS number, including other names
3-Hydroxy-4-nitrobenzoic acid 98% (CAS 619-14-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117757-5g |
| cas | 619-14-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 709.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117757 |
3-hydroxy-4-nitrobenzoic acid (CAS 619-14-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-4-nitrobenzoic acid. InChIKey: XLDLRRGZWIEEHT-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-4-nitrobenzoic acid |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)