cas: 35233-17-1 — see every product listed under this CAS number, including other names
3-Hydroxy-8-methoxy-6H-dibenzo[b,d]pyran-6-one, 95%, 95% (CAS 35233-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMUF-100mg |
| cas | 35233-17-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 314.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-8-methoxybenzo[c]chromen-6-one (CAS 35233-17-1) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 3-hydroxy-8-methoxybenzo[c]chromen-6-one. InChIKey: IGJLBTGXYKPECW-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-hydroxy-8-methoxybenzo[c]chromen-6-one |
| InChIKey | IGJLBTGXYKPECW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(C=C(C=C3)O)OC2=O |
Computed by PubChem (NCBI)