3-Iodo-1h-indole-7-carboxylic acid, 97%
cas: 1360953-77-0 — see every product listed under this CAS number, including other names
3-Iodo-1h-indole-7-carboxylic acid, 97% (CAS 1360953-77-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-4346-5g |
| cas | 1360953-77-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1510.69 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 542.06 Pln | |
| BLDpharm | 5g | 1625.01 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1144.40 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Fluorochem | 100mg | 242.64 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 2116.98 Pln | |
| Fluorochem | 10g | 3934.05 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-iodo-1H-indole-7-carboxylic acid (CAS 1360953-77-0) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 3-iodo-1H-indole-7-carboxylic acid. InChIKey: XPFPSGUINDMCAV-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 3-iodo-1H-indole-7-carboxylic acid |
| InChIKey | XPFPSGUINDMCAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=C2I |
Computed by PubChem (NCBI)