CAS 1379361-25-7 appears in our catalog under these names: Methyl 4-cyano-3-iodobenzoate, 95%, Methyl 4-cyano-3-iodobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Methyl 4-cyano-3-iodobenzoate (CAS 1379361-25-7) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: methyl 4-cyano-3-iodobenzoate. InChIKey: YCKAZHVRMXXYSS-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | methyl 4-cyano-3-iodobenzoate |
| InChIKey | YCKAZHVRMXXYSS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C#N)I |
Computed by PubChem (NCBI)