CAS 167631-58-5 appears in our catalog under these names: 3-Iodo-1h-indole-2-carboxylic acid, 95%, 3-Iodo-1H-indole-2-carboxylic acid, 96%, 96%, 3-Iodoindole-2-carboxylic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
3-iodo-1H-indole-2-carboxylic acid (CAS 167631-58-5) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 3-iodo-1H-indole-2-carboxylic acid. InChIKey: BKUHHQRXJHGQCF-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 3-iodo-1H-indole-2-carboxylic acid |
| InChIKey | BKUHHQRXJHGQCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)I |
Computed by PubChem (NCBI)