Products 219841-91-5
CAS 219841-91-5 appears in our catalog under these names: Methyl 5–Cyano–2–Iodobenzoate, Methyl 5-cyano-2-iodobenzoate, 95%, Methyl 5-cyano-2-iodobenzoate, 98+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
Methyl 5-cyano-2-iodobenzoate (CAS 219841-91-5) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: methyl 5-cyano-2-iodobenzoate. InChIKey: SSXDDLXAVMYVKR-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | methyl 5-cyano-2-iodobenzoate |
| InChIKey | SSXDDLXAVMYVKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)I |
Computed by PubChem (NCBI)