CAS 76443-45-3 is the registry number for 5-Iodo-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-2-methyl-3,1-benzoxazin-4-one (CAS 76443-45-3) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 5-iodo-2-methyl-3,1-benzoxazin-4-one. InChIKey: DUUDVMXDNXOWRP-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 5-iodo-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | DUUDVMXDNXOWRP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC=C2)I)C(=O)O1 |
Computed by PubChem (NCBI)