Products 1190847-04-1
CAS 1190847-04-1 appears in our catalog under these names: 5-Iodo-1h-indole-3-carboxylic acid, 95%, 5-Iodo-1H-indole-3-carboxylic acid, 98%, 5–Iodo–1H–indole–3–carboxylic acid, 5-Iodo-1H-Indole-3-Carboxylic Acid, 97%, 97%, 5-Iodo-1H-indole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-iodo-1H-indole-3-carboxylic acid (CAS 1190847-04-1) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 5-iodo-1H-indole-3-carboxylic acid. InChIKey: ALHAYYZMAAKVSE-UHFFFAOYSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 5-iodo-1H-indole-3-carboxylic acid |
| InChIKey | ALHAYYZMAAKVSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)