CAS 1841079-89-7 is the registry number for (E)-2-(Hydroxyimino)-6-iodo-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2E)-2-hydroxyimino-6-iodo-3H-inden-1-one (CAS 1841079-89-7) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: (2E)-2-hydroxyimino-6-iodo-3H-inden-1-one. InChIKey: YTAKZEWHFWHQSB-DHZHZOJOSA-N.
| Molecular formula | C9H6INO2 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | (2E)-2-hydroxyimino-6-iodo-3H-inden-1-one |
| InChIKey | YTAKZEWHFWHQSB-DHZHZOJOSA-N |
| SMILES | C\1C2=C(C=C(C=C2)I)C(=O)/C1=N/O |
Computed by PubChem (NCBI)