Products 1419518-18-5

CAS 1419518-18-5 is the registry number for 6-Iodo-1H-indole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-iodo-1H-indole-3-carboxylic acid (CAS 1419518-18-5) is a chemical compound with the molecular formula C9H6INO2 and a molecular weight of 287.05 g/mol. IUPAC name: 6-iodo-1H-indole-3-carboxylic acid. InChIKey: AXYULVYRXYXUGV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6INO2
Molecular weight287.05 g/mol
IUPAC name6-iodo-1H-indole-3-carboxylic acid
InChIKeyAXYULVYRXYXUGV-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1I)NC=C2C(=O)O

Computed by PubChem (NCBI)