3-Methoxy-1-naphthoic acid, 98%
cas: 147397-60-2 — see every product listed under this CAS number, including other names
3-Methoxy-1-naphthoic acid, 98% (CAS 147397-60-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F620956-100MG |
| cas | 147397-60-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 976.69 Pln | |
| Ambeed | 5g | 4586.75 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 1047.43 Pln | |
| BLDpharm | 5g | 4940.51 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-methoxynaphthalene-1-carboxylic acid (CAS 147397-60-2) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methoxynaphthalene-1-carboxylic acid. InChIKey: KDCWMJAKDVZCAO-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-methoxynaphthalene-1-carboxylic acid |
| InChIKey | KDCWMJAKDVZCAO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)