cas: 33224-19-0 — see every product listed under this CAS number, including other names
3-Methoxy-5-nitrobenzonitrile, 96% (CAS 33224-19-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236524-1G |
| cas | 33224-19-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 669.57 Pln | |
| Fluorochem | 10g | 872.63 Pln | |
| Fluorochem | 25g | 1783.76 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxy-5-nitrobenzonitrile (CAS 33224-19-0) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-methoxy-5-nitrobenzonitrile. InChIKey: IULAXWUZAPAHIH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-methoxy-5-nitrobenzonitrile |
| InChIKey | IULAXWUZAPAHIH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)