cas: 33224-19-0 — see every product listed under this CAS number, including other names
3-methoxy-5-nitrobenzonitrile, 96%, 96% (CAS 33224-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKQA-100mg |
| cas | 33224-19-0 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1514.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-5-nitrobenzonitrile (CAS 33224-19-0) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-methoxy-5-nitrobenzonitrile. InChIKey: IULAXWUZAPAHIH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-methoxy-5-nitrobenzonitrile |
| InChIKey | IULAXWUZAPAHIH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)