cas: 95532-74-4 — see every product listed under this CAS number, including other names
3-Methyl-6-nitrocoumarin (CAS 95532-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023436-1G |
| cas | 95532-74-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1388.07 Pln | |
| Fluorochem | 10g | 2455.40 Pln | |
| Fluorochem | 25g | 4735.85 Pln |
| delivery time | 2-3 weeks |
|---|
3-methyl-6-nitrochromen-2-one (CAS 95532-74-4) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 3-methyl-6-nitrochromen-2-one. InChIKey: PWANMOIIIMORBV-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 3-methyl-6-nitrochromen-2-one |
| InChIKey | PWANMOIIIMORBV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)[N+](=O)[O-])OC1=O |
Computed by PubChem (NCBI)