CAS 117140-77-9 appears in our catalog under these names: Indole-2,5-dicarboxylic acid, 97%, 1H-Indole-2,5-dicarboxylic acid, 97%, 97%, 1H-Indole-2,5-dicarboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 250mg.
1H-indole-2,5-dicarboxylic acid (CAS 117140-77-9) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,5-dicarboxylic acid. InChIKey: MUABQYJAPOQWCH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,5-dicarboxylic acid |
| InChIKey | MUABQYJAPOQWCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)