CAS 56304-44-0 is the registry number for 6-(Furan-2-yl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(furan-2-yl)-2-oxo-1H-pyridine-3-carboxylic acid (CAS 56304-44-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 6-(furan-2-yl)-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: VQKSLZHHOKQLSA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 6-(furan-2-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | VQKSLZHHOKQLSA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)