CAS 103027-97-0 appears in our catalog under these names: 1H-Indole-2,6-dicarboxylic acid, 97%, 97%, 1H-Indole-2,6-dicarboxylic acid, 97%, 1H-Indole-2,6-dicarboxylic acid, 98%, 1H–Indole–2,6–dicarboxylic acid, 1H-Indole-2,6-dicarboxylic acid. Offered by: Chemat, Combi-blocks, Ambeed, GLPBio, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10g, 5g, 25g.
1H-indole-2,6-dicarboxylic acid (CAS 103027-97-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,6-dicarboxylic acid. InChIKey: WXXRCNKKYCNYFF-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,6-dicarboxylic acid |
| InChIKey | WXXRCNKKYCNYFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)