Products 1820710-62-0

CAS 1820710-62-0 is the registry number for 2-(Cyanomethyl)benzene-1,4-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(cyanomethyl)terephthalic acid (CAS 1820710-62-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 2-(cyanomethyl)terephthalic acid. InChIKey: YBMCIMFPZISSIU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO4
Molecular weight205.17 g/mol
IUPAC name2-(cyanomethyl)terephthalic acid
InChIKeyYBMCIMFPZISSIU-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)CC#N)C(=O)O

Computed by PubChem (NCBI)