CAS 56720-83-3 is the registry number for Methyl 1,3-dioxo-2H-isoindole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 1,3-dioxoisoindole-5-carboxylate (CAS 56720-83-3) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: methyl 1,3-dioxoisoindole-5-carboxylate. InChIKey: JRFHQEZVUKIDMX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | methyl 1,3-dioxoisoindole-5-carboxylate |
| InChIKey | JRFHQEZVUKIDMX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)