Products 103030-09-7
CAS 103030-09-7 appears in our catalog under these names: 1H-Indole-2,3-dicarboxylic acid, 95%, 1H–Indole–2，3–dicarboxylic acid, 1H-Indole-2,3-dicarboxylic acid 95%, 1H-Indole-2,3-dicarboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1H-indole-2,3-dicarboxylic acid (CAS 103030-09-7) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1H-indole-2,3-dicarboxylic acid. InChIKey: MBNROFBGTNXXMX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1H-indole-2,3-dicarboxylic acid |
| InChIKey | MBNROFBGTNXXMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)