Products 106517-64-0

CAS 106517-64-0 is the registry number for 5H-[1,3]Dioxolo[4,5-f]indole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid (CAS 106517-64-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid. InChIKey: BJRAHWGTBUCWCY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO4
Molecular weight205.17 g/mol
IUPAC name5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid
InChIKeyBJRAHWGTBUCWCY-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C=C3C(=C2)C=C(N3)C(=O)O

Computed by PubChem (NCBI)