CAS 106517-64-0 is the registry number for 5H-[1,3]Dioxolo[4,5-f]indole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid (CAS 106517-64-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid. InChIKey: BJRAHWGTBUCWCY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5H-[1,3]dioxolo[4,5-f]indole-6-carboxylic acid |
| InChIKey | BJRAHWGTBUCWCY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C=C(N3)C(=O)O |
Computed by PubChem (NCBI)