cas: 162848-25-1 — see every product listed under this CAS number, including other names
3-Nitro-4-(1-pyrazolyl)benzoic Acid 97% (CAS 162848-25-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145088-1g |
| cas | 162848-25-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 904.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A145088 |
3-nitro-4-pyrazol-1-ylbenzoic acid (CAS 162848-25-1) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 3-nitro-4-pyrazol-1-ylbenzoic acid. InChIKey: YPKLOOQBMQJXKS-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 3-nitro-4-pyrazol-1-ylbenzoic acid |
| InChIKey | YPKLOOQBMQJXKS-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)