Products 448187-56-2

CAS 448187-56-2 appears in our catalog under these names: 3-(3-Nitrophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 3-(3-Nitrophenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

5-(3-nitrophenyl)-1H-pyrazole-4-carboxylic acid (CAS 448187-56-2) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 5-(3-nitrophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: HIHZVKRTUUSORZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name5-(3-nitrophenyl)-1H-pyrazole-4-carboxylic acid
InChIKeyHIHZVKRTUUSORZ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C2=C(C=NN2)C(=O)O

Computed by PubChem (NCBI)