Products 1272840-24-0

CAS 1272840-24-0 is the registry number for 1-(2-Nitrophenyl)imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2-nitrophenyl)imidazole-4-carboxylic acid (CAS 1272840-24-0) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 1-(2-nitrophenyl)imidazole-4-carboxylic acid. InChIKey: DWFBADCKEKTAOF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name1-(2-nitrophenyl)imidazole-4-carboxylic acid
InChIKeyDWFBADCKEKTAOF-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)N2C=C(N=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)