Products 1557038-82-0

CAS 1557038-82-0 appears in our catalog under these names: 5-(3-Nitrophenyl)-1h-pyrazole-3-carboxylic acid, 95%, 5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 95+%, 95+%, 5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg, 1000mg, 2000mg.

Structural formula: {0} (CAS {1})

3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1557038-82-0) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: KOYVJIGBLQRTRF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyKOYVJIGBLQRTRF-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C2=NNC(=C2)C(=O)O

Computed by PubChem (NCBI)