CAS 167626-67-7 appears in our catalog under these names: 4-(1H-Imidazol-1-yl)-3-nitrobenzoic acid, 95%, 4-(1H-imidazol-1-yl)-3-nitrobenzoic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
4-imidazol-1-yl-3-nitrobenzoic acid (CAS 167626-67-7) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 4-imidazol-1-yl-3-nitrobenzoic acid. InChIKey: FLYKERXELOIGQB-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 4-imidazol-1-yl-3-nitrobenzoic acid |
| InChIKey | FLYKERXELOIGQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N2C=CN=C2 |
Computed by PubChem (NCBI)