Products 167626-67-7

CAS 167626-67-7 appears in our catalog under these names: 4-(1H-Imidazol-1-yl)-3-nitrobenzoic acid, 95%, 4-(1H-imidazol-1-yl)-3-nitrobenzoic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-imidazol-1-yl-3-nitrobenzoic acid (CAS 167626-67-7) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 4-imidazol-1-yl-3-nitrobenzoic acid. InChIKey: FLYKERXELOIGQB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name4-imidazol-1-yl-3-nitrobenzoic acid
InChIKeyFLYKERXELOIGQB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N2C=CN=C2

Computed by PubChem (NCBI)