CAS 1246648-80-5 appears in our catalog under these names: 1-(6-Nitro-1,3-benzodioxol-5-yl)-1h-imidazole, 95%, 1-(6-Nitrobenzo(d)(1,3)dioxol-5-yl)-1H-imidazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(6-nitro-1,3-benzodioxol-5-yl)imidazole (CAS 1246648-80-5) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 1-(6-nitro-1,3-benzodioxol-5-yl)imidazole. InChIKey: PBBZTWZMOGNBAI-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 1-(6-nitro-1,3-benzodioxol-5-yl)imidazole |
| InChIKey | PBBZTWZMOGNBAI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)N3C=CN=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)