Products 35581-31-8

CAS 35581-31-8 is the registry number for 3-(4-Nitrophenyl)-pyrazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid (CAS 35581-31-8) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 5-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid. InChIKey: VOICPTATNWDOES-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name5-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid
InChIKeyVOICPTATNWDOES-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(C=NN2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)