CAS 162848-25-1 appears in our catalog under these names: 3–Nitro–4–(1–pyrazolyl)benzoic Acid, 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid, 97%, 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid, >97%, >97%, 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid, >97%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
3-nitro-4-pyrazol-1-ylbenzoic acid (CAS 162848-25-1) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 3-nitro-4-pyrazol-1-ylbenzoic acid. InChIKey: YPKLOOQBMQJXKS-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 3-nitro-4-pyrazol-1-ylbenzoic acid |
| InChIKey | YPKLOOQBMQJXKS-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)