cas: 483282-25-3 — see every product listed under this CAS number, including other names
3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-5-carboxylic acid, 95%, 95% (CAS 483282-25-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E88A-25mg |
| cas | 483282-25-3 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 270.80 Pln | |
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 1g | 1826.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-oxo-4H-1,4-benzoxazine-5-carboxylic acid (CAS 483282-25-3) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-5-carboxylic acid. InChIKey: OCBVWXXCVFAUBS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-5-carboxylic acid |
| InChIKey | OCBVWXXCVFAUBS-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)