CAS 33545-42-5 appears in our catalog under these names: 3-(Furan-2-yl)isoxazole-5-carboxylic acid, 95%, Methyl 3-(furan-2-yl)isoxazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-(furan-2-yl)-1,2-oxazole-5-carboxylate (CAS 33545-42-5) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 3-(furan-2-yl)-1,2-oxazole-5-carboxylate. InChIKey: GGQNXHGUQREERU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 3-(furan-2-yl)-1,2-oxazole-5-carboxylate |
| InChIKey | GGQNXHGUQREERU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NO1)C2=CC=CO2 |
Computed by PubChem (NCBI)