cas: 200195-15-9 — see every product listed under this CAS number, including other names
3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carbaldehyde 98% (CAS 200195-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A433315-100mg |
| cas | 200195-15-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1004.50 Pln | |
| Ambeed | 5g | 2806.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A433315 |
3-oxo-4H-1,4-benzoxazine-6-carbaldehyde (CAS 200195-15-9) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-6-carbaldehyde. InChIKey: VHKABBARGFUYOF-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-6-carbaldehyde |
| InChIKey | VHKABBARGFUYOF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C=O |
Computed by PubChem (NCBI)