cas: 3384-05-2 — see every product listed under this CAS number, including other names
3-Phenoxypropane-1-sulfonyl chloride, 97%, 97% (CAS 3384-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12ARY8-100mg |
| cas | 3384-05-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 500mg | 1302.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-phenoxypropane-1-sulfonyl chloride (CAS 3384-05-2) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 3-phenoxypropane-1-sulfonyl chloride. InChIKey: KQQXONXRBRPWRN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 3-phenoxypropane-1-sulfonyl chloride |
| InChIKey | KQQXONXRBRPWRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)