cas: 885281-16-3 — see every product listed under this CAS number, including other names
3-Phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine, 97% (CAS 885281-16-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225128-100MG |
| cas | 885281-16-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 1g | 1684.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (CAS 885281-16-3) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine. InChIKey: LBNUCZQUHKEDBA-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| InChIKey | LBNUCZQUHKEDBA-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=C2C3=CC=CC=C3)CN1 |
Computed by PubChem (NCBI)