cas: 92028-21-2 — see every product listed under this CAS number, including other names
3-Phenyl-p-anisidine hydrochloride, 97% (CAS 92028-21-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018953-250MG |
| cas | 92028-21-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 1002.79 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-methoxy-3-phenylaniline;hydrochloride (CAS 92028-21-2) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 4-methoxy-3-phenylaniline;hydrochloride. InChIKey: ONIVGWWTHRIXHL-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 4-methoxy-3-phenylaniline;hydrochloride |
| InChIKey | ONIVGWWTHRIXHL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)