cas: 883-62-5 — see every product listed under this CAS number, including other names
3-methoxy-2-naphthoic acid, 95% (CAS 883-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F374715-1G |
| cas | 883-62-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1231.88 Pln | |
| Fluorochem | 25g | 2502.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-methoxynaphthalene-2-carboxylic acid (CAS 883-62-5) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methoxynaphthalene-2-carboxylic acid. InChIKey: RTBQQRFTCVDODF-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-methoxynaphthalene-2-carboxylic acid |
| InChIKey | RTBQQRFTCVDODF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C=C1C(=O)O |
Computed by PubChem (NCBI)