cas: 61553-71-7 — see every product listed under this CAS number, including other names
3H-Pyrimido[5,4-b]indol-4(5H)-one, 95% (CAS 61553-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446035-100MG |
| cas | 61553-71-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 3762.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dihydropyrimido[5,4-b]indol-4-one (CAS 61553-71-7) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,5-dihydropyrimido[5,4-b]indol-4-one. InChIKey: SQKANMIJNAMTAQ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,5-dihydropyrimido[5,4-b]indol-4-one |
| InChIKey | SQKANMIJNAMTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)