cas: 61553-71-7 — see every product listed under this CAS number, including other names
3H-Pyrimido[5,4-b]indol-4(5H)-one (CAS 61553-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELA7-100mg |
| cas | 61553-71-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2176.40 Pln |
| delivery time | 3 weeks |
|---|
3,5-dihydropyrimido[5,4-b]indol-4-one (CAS 61553-71-7) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 3,5-dihydropyrimido[5,4-b]indol-4-one. InChIKey: SQKANMIJNAMTAQ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3,5-dihydropyrimido[5,4-b]indol-4-one |
| InChIKey | SQKANMIJNAMTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)