cas: 6889-78-7 — see every product listed under this CAS number, including other names
4'-Methoxyflavonol 98% (CAS 6889-78-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A652025-25g |
| cas | 6889-78-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 3958.19 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1182.50 Pln | |
| Ambeed | 10g | 2011.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A652025 |
3-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 6889-78-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: IIBBFGMVMNZMGA-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)