CAS 3365-85-3 appears in our catalog under these names: 4,4'-Diamino-p-terphenyl/ 98%, (1,1':4',1''–terphenyl)–4,4''–diamine, 4,4''-Diamino-p-terphenyl, 95% , 4,4''-Diamino-p-terphenyl, >98.0%(HPLC)(T), [1,1':4',1''-terphenyl]-4,4''-diamine, 98%, 98%. Offered by: Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100g.
4-[4-(4-aminophenyl)phenyl]aniline (CAS 3365-85-3) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-[4-(4-aminophenyl)phenyl]aniline. InChIKey: QBSMHWVGUPQNJJ-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-[4-(4-aminophenyl)phenyl]aniline |
| InChIKey | QBSMHWVGUPQNJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)