CAS 130821-37-3 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-4,4''-diamine 98%, [1,1':3',1''-Terphenyl]-4,4''-diamine, 98%, [1,1':3',1''-Terphenyl]-4,4''-diamine, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
4-[3-(4-aminophenyl)phenyl]aniline (CAS 130821-37-3) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-[3-(4-aminophenyl)phenyl]aniline. InChIKey: BOVVHULZWVFIOX-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-[3-(4-aminophenyl)phenyl]aniline |
| InChIKey | BOVVHULZWVFIOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)