CAS 116724-06-2 appears in our catalog under these names: N1,N1-Diphenylbenzene-1,3-diamine, 98%, N1,N1-Diphenylbenzene-1,3-diamine, 98%, 98%, N1,N1-Diphenyl-1,3-benzenediamine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-N,3-N-diphenylbenzene-1,3-diamine (CAS 116724-06-2) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 3-N,3-N-diphenylbenzene-1,3-diamine. InChIKey: RSPHWOYYWACCJK-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 3-N,3-N-diphenylbenzene-1,3-diamine |
| InChIKey | RSPHWOYYWACCJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC(=C3)N |
Computed by PubChem (NCBI)