CAS 1445086-62-3 appears in our catalog under these names: Ibrutinib Impurity 26, 5-Methyl-N,N-diphenyl-2-pyridinamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
5-methyl-N,N-diphenylpyridin-2-amine (CAS 1445086-62-3) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 5-methyl-N,N-diphenylpyridin-2-amine. InChIKey: OULURFWRUQJXSY-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 5-methyl-N,N-diphenylpyridin-2-amine |
| InChIKey | OULURFWRUQJXSY-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)