CAS 5905-36-2 appears in our catalog under these names: N,N'–diphenyl–m–phenylenediamine, N1,N3-Diphenyl-1,3-benzenediamine, 98%, 98%, m-Phenylenediamine, N,N-diphenyl-, 98%, N1,N3-Diphenylbenzene-1,3-diamine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
1-N,3-N-diphenylbenzene-1,3-diamine (CAS 5905-36-2) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 1-N,3-N-diphenylbenzene-1,3-diamine. InChIKey: WULZIURTBVLJRF-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-N,3-N-diphenylbenzene-1,3-diamine |
| InChIKey | WULZIURTBVLJRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)