cas: 5384-21-4 — see every product listed under this CAS number, including other names
4,4'-Methylenebis(2,6-dimethylphenol), >98.0%(GC) (CAS 5384-21-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1099-25G |
| cas | 5384-21-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 305.20 Pln | |
| TCI | 500g | 2576.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol (CAS 5384-21-4) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol. InChIKey: AZZWZMUXHALBCQ-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| InChIKey | AZZWZMUXHALBCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)CC2=CC(=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)