cas: 24197-34-0 — see every product listed under this CAS number, including other names
4,4'-Thiobis(2-methylphenol), 98%, 98% (CAS 24197-34-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O0K-25g |
| cas | 24197-34-0 |
| size | 25g |
| availability | 1200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 189.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol (CAS 24197-34-0) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol. InChIKey: IBNFPRMKLZDANU-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol |
| InChIKey | IBNFPRMKLZDANU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SC2=CC(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)