cas: 24197-34-0 — see every product listed under this CAS number, including other names
4,4'-Thiobis(2-methylphenol) (CAS 24197-34-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727538-25G |
| cas | 24197-34-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 5g | 122.89 Pln |
| delivery time | 3-4 weeks |
|---|
4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol (CAS 24197-34-0) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol. InChIKey: IBNFPRMKLZDANU-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 4-(4-hydroxy-3-methylphenyl)sulfanyl-2-methylphenol |
| InChIKey | IBNFPRMKLZDANU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SC2=CC(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)