cas: 599-66-6 — see every product listed under this CAS number, including other names
4,4-Sulfonylbis(methylbenzene) 98% (CAS 599-66-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165108-5g |
| cas | 599-66-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 921.06 Pln | |
| Ambeed | 500g | 3485.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165108 |
1-methyl-4-(4-methylphenyl)sulfonylbenzene (CAS 599-66-6) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfonylbenzene. InChIKey: WEAYCYAIVOIUMG-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfonylbenzene |
| InChIKey | WEAYCYAIVOIUMG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)