4,5-Dichloro-1h-indole-2-carboxylic acid, 97%
cas: 231295-84-4 — see every product listed under this CAS number, including other names
4,5-Dichloro-1h-indole-2-carboxylic acid, 97% (CAS 231295-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F663507-100MG |
| cas | 231295-84-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1070.47 Pln | |
| Fluorochem | 1g | 2606.39 Pln | |
| Fluorochem | 5g | 10291.19 Pln | |
| Ambeed | 100mg | 704.12 Pln | |
| Ambeed | 250mg | 1049.00 Pln | |
| Ambeed | 1g | 2500.81 Pln | |
| Ambeed | 5g | 7078.75 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1557.20 Pln | |
| Chemat | 5g | 7312.40 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4,5-dichloro-1H-indole-2-carboxylic acid (CAS 231295-84-4) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 4,5-dichloro-1H-indole-2-carboxylic acid. InChIKey: STMAOBOTFAMOLD-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 4,5-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | STMAOBOTFAMOLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)